C12H24N2O2 — CID 115618659
N,N-diethyl-2,2,6-trimethylmorpholine-4-carboxamide (PubChem CID 115618659) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N-diethyl-2,2,6-trimethylmorpholine-4-carboxamide.
| Compound Name | N,N-diethyl-2,2,6-trimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 115618659 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N-diethyl-2,2,6-trimethylmorpholine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-6-13(7-2)11(15)14-8-10(3)16-12(4,5)9-14/h10H,6-9H2,1-5H3 |
| InChIKey | PVIVLMZBJVLLMK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |