C11H22N2O3 — CID 166255971
2-[methoxy(methyl)amino]-1-(2,2,6-trimethylmorpholin-4-yl)ethanone (PubChem CID 166255971) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[methoxy(methyl)amino]-1-(2,2,6-trimethylmorpholin-4-yl)ethanone.
| Compound Name | 2-[methoxy(methyl)amino]-1-(2,2,6-trimethylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 166255971 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-[methoxy(methyl)amino]-1-(2,2,6-trimethylmorpholin-4-yl)ethanone |
| SMILES | CON(C)CC(=O)N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-9-6-13(8-11(2,3)16-9)10(14)7-12(4)15-5/h9H,6-8H2,1-5H3 |
| InChIKey | IDFIBYNDAZOMNC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|