C13H21N3O4 — CID 48689001
1-methyl-3-[2-oxo-2-(2,2,6-trimethylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 48689001) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-methyl-3-[2-oxo-2-(2,2,6-trimethylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[2-oxo-2-(2,2,6-trimethylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 48689001 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-methyl-3-[2-oxo-2-(2,2,6-trimethylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1CN(C(=O)CN2C(=O)CN(C)C2=O)CC(C)(C)O1 |
| InChI | InChI=1S/C13H21N3O4/c1-9-5-15(8-13(2,3)20-9)10(17)7-16-11(18)6-14(4)12(16)19/h9H,5-8H2,1-4H3 |
| InChIKey | ANXVQDOZYCWKRJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|