C21H38N2O4 — CID 136512690
2,2-dimethyl-1,5-bis(2,2,6-trimethylmorpholin-4-yl)pentane-1,5-dione (PubChem CID 136512690) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2,2-dimethyl-1,5-bis(2,2,6-trimethylmorpholin-4-yl)pentane-1,5-dione.
| Compound Name | 2,2-dimethyl-1,5-bis(2,2,6-trimethylmorpholin-4-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 136512690 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 2,2-dimethyl-1,5-bis(2,2,6-trimethylmorpholin-4-yl)pentane-1,5-dione |
| SMILES | CC1CN(C(=O)CCC(C)(C)C(=O)N2CC(C)OC(C)(C)C2)CC(C)(C)O1 |
| InChI | InChI=1S/C21H38N2O4/c1-15-11-22(13-20(5,6)26-15)17(24)9-10-19(3,4)18(25)23-12-16(2)27-21(7,8)14-23/h15-16H,9-14H2,1-8H3 |
| InChIKey | QZOGXLUSRQICCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |