C9H13IO4 — CID 163925190
cyclopropyl 2-iodo-2,5-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 163925190) has the molecular formula C9H13IO4 and a molecular weight of 312.10 g/mol. Its IUPAC name is cyclopropyl 2-iodo-2,5-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | cyclopropyl 2-iodo-2,5-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 163925190 |
| Molecular Formula | C9H13IO4 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | cyclopropyl 2-iodo-2,5-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC1OC(C)(I)OC1C(=O)OC1CC1 |
| InChI | InChI=1S/C9H13IO4/c1-5-7(14-9(2,10)13-5)8(11)12-6-3-4-6/h5-7H,3-4H2,1-2H3 |
| InChIKey | RDVZGVCDDCXVPF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|