C26H46N2O4 — CID 140895326
[4-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxycyclohexyl] 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate (PubChem CID 140895326) has the molecular formula C26H46N2O4 and a molecular weight of 450.66 g/mol. Its IUPAC name is [4-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxycyclohexyl] 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate.
| Compound Name | [4-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxycyclohexyl] 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 140895326 |
| Molecular Formula | C26H46N2O4 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | [4-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxycyclohexyl] 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
| SMILES | CN1C(C)(C)CC(C(=O)OC2CCC(OC(=O)C3CC(C)(C)N(C)C3(C)C)CC2)C1(C)C |
| InChI | InChI=1S/C26H46N2O4/c1-23(2)15-19(25(5,6)27(23)9)21(29)31-17-11-13-18(14-12-17)32-22(30)20-16-24(3,4)28(10)26(20,7)8/h17-20H,11-16H2,1-10H3 |
| InChIKey | KUOCPVQGIFWDSX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |