C25H37NO4 — CID 138724194
[4-(4-methylphenoxy)carbonylcyclohexyl]methyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate (PubChem CID 138724194) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [4-(4-methylphenoxy)carbonylcyclohexyl]methyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate.
| Compound Name | [4-(4-methylphenoxy)carbonylcyclohexyl]methyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138724194 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [4-(4-methylphenoxy)carbonylcyclohexyl]methyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCC(COC(=O)C3CC(C)(C)N(C)C3(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H37NO4/c1-17-7-13-20(14-8-17)30-22(27)19-11-9-18(10-12-19)16-29-23(28)21-15-24(2,3)26(6)25(21,4)5/h7-8,13-14,18-19,21H,9-12,15-16H2,1-6H3 |
| InChIKey | PYSRYXJPENLCBJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|