C26H31NO7 — CID 59428985
4-O-[4-[2-(dimethylcarbamoyloxy)ethoxy]phenyl] 1-O-(4-methylphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 59428985) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-O-[4-[2-(dimethylcarbamoyloxy)ethoxy]phenyl] 1-O-(4-methylphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[2-(dimethylcarbamoyloxy)ethoxy]phenyl] 1-O-(4-methylphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59428985 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-O-[4-[2-(dimethylcarbamoyloxy)ethoxy]phenyl] 1-O-(4-methylphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OCCOC(=O)N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31NO7/c1-18-4-10-22(11-5-18)33-24(28)19-6-8-20(9-7-19)25(29)34-23-14-12-21(13-15-23)31-16-17-32-26(30)27(2)3/h4-5,10-15,19-20H,6-9,16-17H2,1-3H3 |
| InChIKey | CIIHMZUNWXFAQJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|