C25H46N2O4 — CID 140895401
3-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxypentyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate (PubChem CID 140895401) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 3-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxypentyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate.
| Compound Name | 3-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxypentyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 140895401 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 3-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)oxypentyl 1,2,2,5,5-pentamethylpyrrolidine-3-carboxylate |
| SMILES | CCC(CCOC(=O)C1CC(C)(C)N(C)C1(C)C)OC(=O)C1CC(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C25H46N2O4/c1-12-17(31-21(29)19-16-23(4,5)27(11)25(19,8)9)13-14-30-20(28)18-15-22(2,3)26(10)24(18,6)7/h17-19H,12-16H2,1-11H3 |
| InChIKey | IAIFVLKQXLWMMU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |