C26H48N2O6 — CID 140895409
6-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 140895409) has the molecular formula C26H48N2O6 and a molecular weight of 484.68 g/mol. Its IUPAC name is 6-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | 6-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 140895409 |
| Molecular Formula | C26H48N2O6 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | 6-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CCC(CCCCCOC(=O)C1CC(C)(C)N(O)C1(C)C)OC(=O)C1CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C26H48N2O6/c1-10-18(34-22(30)20-17-24(4,5)28(32)26(20,8)9)14-12-11-13-15-33-21(29)19-16-23(2,3)27(31)25(19,6)7/h18-20,31-32H,10-17H2,1-9H3 |
| InChIKey | NNEWHCWOJAHVIB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|