C27H52N2O5 — CID 145268523
8-formyloxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate;2,2,3,5,5-pentamethylpyrrolidine (PubChem CID 145268523) has the molecular formula C27H52N2O5 and a molecular weight of 484.72 g/mol. Its IUPAC name is 8-formyloxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate;2,2,3,5,5-pentamethylpyrrolidine.
| Compound Name | 8-formyloxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate;2,2,3,5,5-pentamethylpyrrolidine |
|---|---|
| PubChem CID | 145268523 |
| Molecular Formula | C27H52N2O5 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | 8-formyloxyoctyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate;2,2,3,5,5-pentamethylpyrrolidine |
| SMILES | CC1(C)CC(C(=O)OCCCCCCCCOC=O)C(C)(C)N1O.CC1CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C18H33NO5.C9H19N/c1-17(2)13-15(18(3,4)19(17)22)16(21)24-12-10-8-6-5-7-9-11-23-14-20;1-7-6-8(2,3)10-9(7,4)5/h14-15,22H,5-13H2,1-4H3;7,10H,6H2,1-5H3 |
| InChIKey | RVGJSVRMLNHKBL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|