About 5-formyloxypentyl acetate
5-formyloxypentyl acetate (PubChem CID 87520008) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-formyloxypentyl acetate.
Molecular Properties
| Compound Name | 5-formyloxypentyl acetate |
| PubChem CID | 87520008 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-formyloxypentyl acetate |
| SMILES | CC(=O)OCCCCCOC=O |
| InChI | InChI=1S/C8H14O4/c1-8(10)12-6-4-2-3-5-11-7-9/h7H,2-6H2,1H3 |
| InChIKey | HRHXBSKKTOPXED-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-formyloxypentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyloxypentyl acetate?
The IUPAC name of 5-formyloxypentyl acetate (CID 87520008) is 5-formyloxypentyl acetate.
What is the SMILES notation for 5-formyloxypentyl acetate?
The canonical SMILES for 5-formyloxypentyl acetate is CC(=O)OCCCCCOC=O.
What is the InChIKey of 5-formyloxypentyl acetate?
The InChIKey is HRHXBSKKTOPXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-8(10)12-6-4-2-3-5-11-7-9/h7H,2-6H2,1H3.
What are the key properties of 5-formyloxypentyl acetate?
5-formyloxypentyl acetate has a molecular weight of 174.20 g/mol, XLogP of 0.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyloxypentyl acetate is sourced from PubChem (CID 87520008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).