About 4-but-1-enoxybutyl acetate
4-but-1-enoxybutyl acetate (PubChem CID 86593756) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-but-1-enoxybutyl acetate.
Molecular Properties
| Compound Name | 4-but-1-enoxybutyl acetate |
| PubChem CID | 86593756 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-but-1-enoxybutyl acetate |
| SMILES | CCC=COCCCCOC(C)=O |
| InChI | InChI=1S/C10H18O3/c1-3-4-7-12-8-5-6-9-13-10(2)11/h4,7H,3,5-6,8-9H2,1-2H3 |
| InChIKey | AXMYIANZGNOXHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-but-1-enoxybutyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-enoxybutyl acetate?
The IUPAC name of 4-but-1-enoxybutyl acetate (CID 86593756) is 4-but-1-enoxybutyl acetate.
What is the SMILES notation for 4-but-1-enoxybutyl acetate?
The canonical SMILES for 4-but-1-enoxybutyl acetate is CCC=COCCCCOC(C)=O.
What is the InChIKey of 4-but-1-enoxybutyl acetate?
The InChIKey is AXMYIANZGNOXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-4-7-12-8-5-6-9-13-10(2)11/h4,7H,3,5-6,8-9H2,1-2H3.
What are the key properties of 4-but-1-enoxybutyl acetate?
4-but-1-enoxybutyl acetate has a molecular weight of 186.25 g/mol, XLogP of 2.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-enoxybutyl acetate is sourced from PubChem (CID 86593756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).