C33H57N3O7 — CID 138724462
[3,5-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]cyclohexyl] 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 138724462) has the molecular formula C33H57N3O7 and a molecular weight of 607.83 g/mol. Its IUPAC name is [3,5-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]cyclohexyl] 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | [3,5-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]cyclohexyl] 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138724462 |
| Molecular Formula | C33H57N3O7 |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | [3,5-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]cyclohexyl] 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OC2CC(OC(=O)C3CC(C)(C)NC3(C)C)CC(OC(=O)C3CC(C)(C)N(O)C3(C)C)C2)C(C)(C)N1 |
| InChI | InChI=1S/C33H57N3O7/c1-28(2)16-22(31(7,8)34-28)25(37)41-19-13-20(42-26(38)23-17-29(3,4)35-32(23,9)10)15-21(14-19)43-27(39)24-18-30(5,6)36(40)33(24,11)12/h19-24,34-35,40H,13-18H2,1-12H3 |
| InChIKey | ZZPAQERRGOXGIS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|