C26H48N2O4 — CID 138723933
6-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 138723933) has the molecular formula C26H48N2O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is 6-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | 6-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138723933 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | 6-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyoctyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CCC(CCCCCOC(=O)C1CC(C)(C)NC1(C)C)OC(=O)C1CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C26H48N2O4/c1-10-18(32-22(30)20-17-24(4,5)28-26(20,8)9)14-12-11-13-15-31-21(29)19-16-23(2,3)27-25(19,6)7/h18-20,27-28H,10-17H2,1-9H3 |
| InChIKey | WHCHYEWATCHSKL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|