C31H59NO5 — CID 155301817
9-(3,3,6,6-tetramethylcycloheptanecarbonyl)oxynonan-2-yl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate (PubChem CID 155301817) has the molecular formula C31H59NO5 and a molecular weight of 525.82 g/mol. Its IUPAC name is 9-(3,3,6,6-tetramethylcycloheptanecarbonyl)oxynonan-2-yl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate.
| Compound Name | 9-(3,3,6,6-tetramethylcycloheptanecarbonyl)oxynonan-2-yl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate |
|---|---|
| PubChem CID | 155301817 |
| Molecular Formula | C31H59NO5 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.44 |
| IUPAC Name | 9-(3,3,6,6-tetramethylcycloheptanecarbonyl)oxynonan-2-yl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate |
| SMILES | CC(CCCCCCCOC(=O)C1CC(C)(C)CCC(C)(C)C1)OC(=O)C1CC(C)(C)NC(C)(C)C1.O |
| InChI | InChI=1S/C31H57NO4.H2O/c1-23(36-27(34)25-21-30(6,7)32-31(8,9)22-25)15-13-11-10-12-14-18-35-26(33)24-19-28(2,3)16-17-29(4,5)20-24;/h23-25,32H,10-22H2,1-9H3;1H2 |
| InChIKey | WFHIFDWKYYTANV-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|