C46H86N6O6 — CID 67745067
8-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxyoctyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 67745067) has the molecular formula C46H86N6O6 and a molecular weight of 819.23 g/mol. Its IUPAC name is 8-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxyoctyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 8-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxyoctyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 67745067 |
| Molecular Formula | C46H86N6O6 |
| Molecular Weight | 819.23 g/mol |
| Exact Mass | 818.66 |
| IUPAC Name | 8-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxyoctyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CC1(C)CC(C(=O)OCCCCCCCCOC(=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.CC1(C)CN(CCN2CC(C)(C)NC(C)(C)C2=O)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C28H52N2O4.C18H34N4O2/c1-25(2)17-21(18-26(3,4)29-25)23(31)33-15-13-11-9-10-12-14-16-34-24(32)22-19-27(5,6)30-28(7,8)20-22;1-15(2)11-21(13(23)17(5,6)19-15)9-10-22-12-16(3,4)20-18(7,8)14(22)24/h21-22,29-30H,9-20H2,1-8H3;19-20H,9-12H2,1-8H3 |
| InChIKey | HGRZVCGHRHFENV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.23 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|