C21H39NO3 — CID 59359662
octyl 1-octyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 59359662) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is octyl 1-octyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | octyl 1-octyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 59359662 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | octyl 1-octyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CC(=O)N(CCCCCCCC)C1 |
| InChI | InChI=1S/C21H39NO3/c1-3-5-7-9-11-13-15-22-18-19(17-20(22)23)21(24)25-16-14-12-10-8-6-4-2/h19H,3-18H2,1-2H3 |
| InChIKey | PKKSZBLZRRMPSB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|