C20H38N2O3 — CID 139418679
butyl 1-[3-[heptyl(methyl)amino]propyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 139418679) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is butyl 1-[3-[heptyl(methyl)amino]propyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | butyl 1-[3-[heptyl(methyl)amino]propyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139418679 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | butyl 1-[3-[heptyl(methyl)amino]propyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCCCCN(C)CCCN1CC(C(=O)OCCCC)CC1=O |
| InChI | InChI=1S/C20H38N2O3/c1-4-6-8-9-10-12-21(3)13-11-14-22-17-18(16-19(22)23)20(24)25-15-7-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | JBLSDPBHYVFDHL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|