C29H55NO3Pb — CID 16683430
triethylplumbyl 1-octadec-9-enyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 16683430) has the molecular formula C29H55NO3Pb and a molecular weight of 672.96 g/mol. Its IUPAC name is triethylplumbyl 1-octadec-9-enyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | triethylplumbyl 1-octadec-9-enyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 16683430 |
| Molecular Formula | C29H55NO3Pb |
| Molecular Weight | 672.96 g/mol |
| Exact Mass | 673.39 |
| IUPAC Name | triethylplumbyl 1-octadec-9-enyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCCCCCC=CCCCCCCCCN1CC(C(=O)O[Pb](CC)(CC)CC)CC1=O |
| InChI | InChI=1S/C23H41NO3.3C2H5.Pb/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23(26)27)19-22(24)25;3*1-2;/h9-10,21H,2-8,11-20H2,1H3,(H,26,27);3*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | JDESXQHTEDWKAA-UHFFFAOYSA-M |
| XLogP | 8.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|