C10H17NO3 — CID 94069422
methyl (3R)-1-butyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 94069422) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is methyl (3R)-1-butyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-butyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94069422 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | methyl (3R)-1-butyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCN1C[C@H](C(=O)OC)CC1=O |
| InChI | InChI=1S/C10H17NO3/c1-3-4-5-11-7-8(6-9(11)12)10(13)14-2/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | XVYKGBHWNDMREC-MRVPVSSYSA-N |
| XLogP | 0.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |