C11H19NO2 — CID 165444759
cyclopropyl 4,4-dimethylpiperidine-1-carboxylate (PubChem CID 165444759) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is cyclopropyl 4,4-dimethylpiperidine-1-carboxylate.
| Compound Name | cyclopropyl 4,4-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 165444759 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | cyclopropyl 4,4-dimethylpiperidine-1-carboxylate |
| SMILES | CC1(C)CCN(C(=O)OC2CC2)CC1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2)5-7-12(8-6-11)10(13)14-9-3-4-9/h9H,3-8H2,1-2H3 |
| InChIKey | CYKYLLJHDYYLTC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |