About [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate
[4-(iodoamino)cyclohexyl] piperazine-1-carboxylate (PubChem CID 88963460) has the molecular formula C11H20IN3O2
and a molecular weight of 353.20 g/mol. Its IUPAC name is [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate |
| PubChem CID | 88963460 |
| Molecular Formula | C11H20IN3O2 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate |
| SMILES | O=C(OC1CCC(NI)CC1)N1CCNCC1 |
| InChI | InChI=1S/C11H20IN3O2/c12-14-9-1-3-10(4-2-9)17-11(16)15-7-5-13-6-8-15/h9-10,13-14H,1-8H2 |
| InChIKey | YSHUSYNHZXIOLH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate?
The IUPAC name of [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate (CID 88963460) is [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate.
What is the SMILES notation for [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate?
The canonical SMILES for [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate is O=C(OC1CCC(NI)CC1)N1CCNCC1.
What is the InChIKey of [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate?
The InChIKey is YSHUSYNHZXIOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20IN3O2/c12-14-9-1-3-10(4-2-9)17-11(16)15-7-5-13-6-8-15/h9-10,13-14H,1-8H2.
What are the key properties of [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate?
[4-(iodoamino)cyclohexyl] piperazine-1-carboxylate has a molecular weight of 353.20 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(iodoamino)cyclohexyl] piperazine-1-carboxylate is sourced from PubChem (CID 88963460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).