About [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate
[(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate (PubChem CID 124511796) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate |
| PubChem CID | 124511796 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate |
| SMILES | O=C(O[C@@H]1CCNC1)N1CCOCC1 |
| InChI | InChI=1S/C9H16N2O3/c12-9(11-3-5-13-6-4-11)14-8-1-2-10-7-8/h8,10H,1-7H2/t8-/m1/s1 |
| InChIKey | SGNKCGSEEBGHBJ-MRVPVSSYSA-N |
| XLogP | -0.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate?
The IUPAC name of [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate (CID 124511796) is [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate.
What is the SMILES notation for [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate?
The canonical SMILES for [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate is O=C(O[C@@H]1CCNC1)N1CCOCC1.
What is the InChIKey of [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate?
The InChIKey is SGNKCGSEEBGHBJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16N2O3/c12-9(11-3-5-13-6-4-11)14-8-1-2-10-7-8/h8,10H,1-7H2/t8-/m1/s1.
What are the key properties of [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate?
[(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate has a molecular weight of 200.24 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-pyrrolidin-3-yl] morpholine-4-carboxylate is sourced from PubChem (CID 124511796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).