About 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate
4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate (PubChem CID 112747614) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate.
Analyze 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate?
The IUPAC name of 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate (CID 112747614) is 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate.
What is the SMILES notation for 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate?
The canonical SMILES for 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate is O=C(OC1C2CC3CNC1C3C2)N1CCOCC1.
What is the InChIKey of 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate?
The InChIKey is FYQFWVAGSRUJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c16-13(15-1-3-17-4-2-15)18-12-8-5-9-7-14-11(12)10(9)6-8/h8-12,14H,1-7H2.
What are the key properties of 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate?
4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate has a molecular weight of 252.31 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[4.2.1.03,7]nonan-2-yl morpholine-4-carboxylate is sourced from PubChem (CID 112747614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).