C17H29NO3 — CID 170530170
(2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroinden-2-yl) morpholine-4-carboxylate (PubChem CID 170530170) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroinden-2-yl) morpholine-4-carboxylate.
| Compound Name | (2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroinden-2-yl) morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170530170 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroinden-2-yl) morpholine-4-carboxylate |
| SMILES | CC(C)C1(OC(=O)N2CCOCC2)CC2CCCCC2C1 |
| InChI | InChI=1S/C17H29NO3/c1-13(2)17(11-14-5-3-4-6-15(14)12-17)21-16(19)18-7-9-20-10-8-18/h13-15H,3-12H2,1-2H3 |
| InChIKey | MVZQUQVXENZIDZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |