C16H33N3O3 — CID 144963157
3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]propyl morpholine-4-carboxylate;ethane;molecular hydrogen (PubChem CID 144963157) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]propyl morpholine-4-carboxylate;ethane;molecular hydrogen.
| Compound Name | 3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]propyl morpholine-4-carboxylate;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144963157 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | 3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]propyl morpholine-4-carboxylate;ethane;molecular hydrogen |
| SMILES | CC.O=C(OCCCN1C[C@H]2CNC[C@H]2C1)N1CCOCC1.[H][H] |
| InChI | InChI=1S/C14H25N3O3.C2H6.H2/c18-14(17-3-6-19-7-4-17)20-5-1-2-16-10-12-8-15-9-13(12)11-16;1-2;/h12-13,15H,1-11H2;1-2H3;1H/t12-,13+;; |
| InChIKey | SPJCYFJSVQZATI-FQDOXHKTSA-N |
| XLogP | 1.27 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|