C18H28FN3O — CID 121342795
4-[(3E,5Z)-8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-fluoroocta-1,3,5-trien-4-yl]morpholine (PubChem CID 121342795) has the molecular formula C18H28FN3O and a molecular weight of 321.44 g/mol. Its IUPAC name is 4-[(3E,5Z)-8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-fluoroocta-1,3,5-trien-4-yl]morpholine.
| Compound Name | 4-[(3E,5Z)-8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-fluoroocta-1,3,5-trien-4-yl]morpholine |
|---|---|
| PubChem CID | 121342795 |
| Molecular Formula | C18H28FN3O |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 4-[(3E,5Z)-8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-fluoroocta-1,3,5-trien-4-yl]morpholine |
| SMILES | C=C(F)/C=C(\C=C/CCN1CC2CNCC2C1)N1CCOCC1 |
| InChI | InChI=1S/C18H28FN3O/c1-15(19)10-18(22-6-8-23-9-7-22)4-2-3-5-21-13-16-11-20-12-17(16)14-21/h2,4,10,16-17,20H,1,3,5-9,11-14H2/b4-2-,18-10+ |
| InChIKey | SEBPIESGXNTGQX-FUJGRBOTSA-N |
| XLogP | 1.78 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|