C11H16BrNO — CID 138711415
4-[(3E,5Z)-7-bromohepta-1,3,5-trien-4-yl]morpholine (PubChem CID 138711415) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 4-[(3E,5Z)-7-bromohepta-1,3,5-trien-4-yl]morpholine.
| Compound Name | 4-[(3E,5Z)-7-bromohepta-1,3,5-trien-4-yl]morpholine |
|---|---|
| PubChem CID | 138711415 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(3E,5Z)-7-bromohepta-1,3,5-trien-4-yl]morpholine |
| SMILES | C=C/C=C(\C=C/CBr)N1CCOCC1 |
| InChI | InChI=1S/C11H16BrNO/c1-2-4-11(5-3-6-12)13-7-9-14-10-8-13/h2-5H,1,6-10H2/b5-3-,11-4+ |
| InChIKey | VNACAOYIHRFRIL-DVJFJSKXSA-N |
| XLogP | 2.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|