C12H19N3O — CID 171624644
(1E,3E)-N-[(methylideneamino)methyl]-4-morpholin-4-ylhexa-1,3,5-trien-1-amine (PubChem CID 171624644) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (1E,3E)-N-[(methylideneamino)methyl]-4-morpholin-4-ylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-N-[(methylideneamino)methyl]-4-morpholin-4-ylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 171624644 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (1E,3E)-N-[(methylideneamino)methyl]-4-morpholin-4-ylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C=C\NCN=C)N1CCOCC1 |
| InChI | InChI=1S/C12H19N3O/c1-3-12(5-4-6-14-11-13-2)15-7-9-16-10-8-15/h3-6,14H,1-2,7-11H2/b6-4+,12-5+ |
| InChIKey | KKERBERWHKTQDT-ZCGKFZJYSA-N |
| XLogP | 1.15 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|