C15H28N2O — CID 134923533
(1Z,3E)-1-morpholin-4-yl-N,N-dipropylpenta-1,3-dien-1-amine (PubChem CID 134923533) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (1Z,3E)-1-morpholin-4-yl-N,N-dipropylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-morpholin-4-yl-N,N-dipropylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134923533 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (1Z,3E)-1-morpholin-4-yl-N,N-dipropylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C=C(/N(CCC)CCC)N1CCOCC1 |
| InChI | InChI=1S/C15H28N2O/c1-4-7-8-15(16(9-5-2)10-6-3)17-11-13-18-14-12-17/h4,7-8H,5-6,9-14H2,1-3H3/b7-4+,15-8- |
| InChIKey | GMKDWAJPOXMURG-GVEAZFNLSA-N |
| XLogP | 2.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|