C9H13NO — CID 144961397
4-penta-1,2,4-trien-3-ylmorpholine (PubChem CID 144961397) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-penta-1,2,4-trien-3-ylmorpholine.
| Compound Name | 4-penta-1,2,4-trien-3-ylmorpholine |
|---|---|
| PubChem CID | 144961397 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-penta-1,2,4-trien-3-ylmorpholine |
| SMILES | C=C=C(C=C)N1CCOCC1 |
| InChI | InChI=1S/C9H13NO/c1-3-9(4-2)10-5-7-11-8-6-10/h3H,1-2,5-8H2 |
| InChIKey | GHFKXSKEVMBUOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|