C11H17NO2 — CID 123435891
1-morpholin-4-yl-2-propan-2-ylbuta-2,3-dien-1-one (PubChem CID 123435891) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-propan-2-ylbuta-2,3-dien-1-one.
| Compound Name | 1-morpholin-4-yl-2-propan-2-ylbuta-2,3-dien-1-one |
|---|---|
| PubChem CID | 123435891 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-morpholin-4-yl-2-propan-2-ylbuta-2,3-dien-1-one |
| SMILES | C=C=C(C(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C11H17NO2/c1-4-10(9(2)3)11(13)12-5-7-14-8-6-12/h9H,1,5-8H2,2-3H3 |
| InChIKey | ZIPFPPIKPVZZLW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|