C10H17NO3 — CID 58498578
3,3-dimethyl-1-morpholin-4-ylbutane-1,2-dione (PubChem CID 58498578) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3,3-dimethyl-1-morpholin-4-ylbutane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-morpholin-4-ylbutane-1,2-dione |
|---|---|
| PubChem CID | 58498578 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3,3-dimethyl-1-morpholin-4-ylbutane-1,2-dione |
| SMILES | CC(C)(C)C(=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO3/c1-10(2,3)8(12)9(13)11-4-6-14-7-5-11/h4-7H2,1-3H3 |
| InChIKey | WZUWSXJPRPWNSW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|