C15H27NO2 — CID 71319313
2,2,5,5-tetramethyl-4-(morpholin-4-ylmethylidene)hexan-3-one (PubChem CID 71319313) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-4-(morpholin-4-ylmethylidene)hexan-3-one.
| Compound Name | 2,2,5,5-tetramethyl-4-(morpholin-4-ylmethylidene)hexan-3-one |
|---|---|
| PubChem CID | 71319313 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2,2,5,5-tetramethyl-4-(morpholin-4-ylmethylidene)hexan-3-one |
| SMILES | CC(C)(C)C(=O)C(=CN1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C15H27NO2/c1-14(2,3)12(13(17)15(4,5)6)11-16-7-9-18-10-8-16/h11H,7-10H2,1-6H3 |
| InChIKey | KXXGRBLDBRRYBE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|