C14H14F3NO2 — CID 129293911
(Z)-1,1,1-trifluoro-4-morpholin-4-yl-3-phenylbut-3-en-2-one (PubChem CID 129293911) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-morpholin-4-yl-3-phenylbut-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-morpholin-4-yl-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 129293911 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-morpholin-4-yl-3-phenylbut-3-en-2-one |
| SMILES | O=C(/C(=C\N1CCOCC1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)13(19)12(11-4-2-1-3-5-11)10-18-6-8-20-9-7-18/h1-5,10H,6-9H2/b12-10- |
| InChIKey | GXBXWAVODRKUNG-BENRWUELSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|