C12H12F3NO — CID 132542566
(E)-4-(dimethylamino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one (PubChem CID 132542566) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one.
| Compound Name | (E)-4-(dimethylamino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 132542566 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (E)-4-(dimethylamino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
| SMILES | CN(C)/C=C(/C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO/c1-16(2)8-10(11(17)12(13,14)15)9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | WRIRYZQFQHYJJZ-CSKARUKUSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|