C28H30F6N2O2 — CID 129293830
(Z)-4-[ethyl-[4-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one (PubChem CID 129293830) has the molecular formula C28H30F6N2O2 and a molecular weight of 540.55 g/mol. Its IUPAC name is (Z)-4-[ethyl-[4-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-[ethyl-[4-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 129293830 |
| Molecular Formula | C28H30F6N2O2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | (Z)-4-[ethyl-[4-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
| SMILES | CCN(/C=C(\C(=O)C(F)(F)F)c1ccccc1)CCCCN(/C=C(\C(=O)C(F)(F)F)c1ccccc1)CC |
| InChI | InChI=1S/C28H30F6N2O2/c1-3-35(19-23(25(37)27(29,30)31)21-13-7-5-8-14-21)17-11-12-18-36(4-2)20-24(26(38)28(32,33)34)22-15-9-6-10-16-22/h5-10,13-16,19-20H,3-4,11-12,17-18H2,1-2H3/b23-19-,24-20- |
| InChIKey | GOAVYLPYPDMNMA-SRPFLQSCSA-N |
| XLogP | 6.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|