C21H22F3NO — CID 134192725
(Z)-4-(N-ethyl-4-propan-2-ylanilino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one (PubChem CID 134192725) has the molecular formula C21H22F3NO and a molecular weight of 361.41 g/mol. Its IUPAC name is (Z)-4-(N-ethyl-4-propan-2-ylanilino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-(N-ethyl-4-propan-2-ylanilino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 134192725 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (Z)-4-(N-ethyl-4-propan-2-ylanilino)-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
| SMILES | CCN(/C=C(\C(=O)C(F)(F)F)c1ccccc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H22F3NO/c1-4-25(18-12-10-16(11-13-18)15(2)3)14-19(20(26)21(22,23)24)17-8-6-5-7-9-17/h5-15H,4H2,1-3H3/b19-14- |
| InChIKey | FFCMQULAZIWHKA-RGEXLXHISA-N |
| XLogP | 5.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|