C27H33F3N2O — CID 134192750
(Z)-4-[ethyl-[4-[ethyl-[(E)-2-phenylprop-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one (PubChem CID 134192750) has the molecular formula C27H33F3N2O and a molecular weight of 458.57 g/mol. Its IUPAC name is (Z)-4-[ethyl-[4-[ethyl-[(E)-2-phenylprop-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-[ethyl-[4-[ethyl-[(E)-2-phenylprop-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 134192750 |
| Molecular Formula | C27H33F3N2O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (Z)-4-[ethyl-[4-[ethyl-[(E)-2-phenylprop-1-enyl]amino]butyl]amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
| SMILES | CCN(/C=C(\C(=O)C(F)(F)F)c1ccccc1)CCCCN(/C=C(\C)c1ccccc1)CC |
| InChI | InChI=1S/C27H33F3N2O/c1-4-31(20-22(3)23-14-8-6-9-15-23)18-12-13-19-32(5-2)21-25(26(33)27(28,29)30)24-16-10-7-11-17-24/h6-11,14-17,20-21H,4-5,12-13,18-19H2,1-3H3/b22-20+,25-21- |
| InChIKey | VNYUIEJUAXBYGP-FJAVDCPESA-N |
| XLogP | 6.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|