C23H23F3N2O3 — CID 129294071
2-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]ethyl 2,3-dihydro-1H-indole-5-carboxylate (PubChem CID 129294071) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]ethyl 2,3-dihydro-1H-indole-5-carboxylate.
| Compound Name | 2-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]ethyl 2,3-dihydro-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 129294071 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[ethyl-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]amino]ethyl 2,3-dihydro-1H-indole-5-carboxylate |
| SMILES | CCN(/C=C(\C(=O)C(F)(F)F)c1ccccc1)CCOC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C23H23F3N2O3/c1-2-28(15-19(21(29)23(24,25)26)16-6-4-3-5-7-16)12-13-31-22(30)18-8-9-20-17(14-18)10-11-27-20/h3-9,14-15,27H,2,10-13H2,1H3/b19-15- |
| InChIKey | LGSJOGCQDSMBTK-CYVLTUHYSA-N |
| XLogP | 4.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|