C19H22N2O — CID 82257869
2-(benzylamino)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one (PubChem CID 82257869) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(benzylamino)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one.
| Compound Name | 2-(benzylamino)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 82257869 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(benzylamino)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
| SMILES | CCC(NCc1ccccc1)C(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C19H22N2O/c1-2-17(21-13-14-6-4-3-5-7-14)19(22)16-8-9-18-15(12-16)10-11-20-18/h3-9,12,17,20-21H,2,10-11,13H2,1H3 |
| InChIKey | QPPNPQGBYAXDEK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |