C17H25N3O — CID 82256390
2-(1,4-diazepan-1-yl)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one (PubChem CID 82256390) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one.
| Compound Name | 2-(1,4-diazepan-1-yl)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 82256390 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
| SMILES | CCC(C(=O)c1ccc2c(c1)CCN2)N1CCCNCC1 |
| InChI | InChI=1S/C17H25N3O/c1-2-16(20-10-3-7-18-9-11-20)17(21)14-4-5-15-13(12-14)6-8-19-15/h4-5,12,16,18-19H,2-3,6-11H2,1H3 |
| InChIKey | JXGXMHAUNYLFOX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |