C15H24N4O — CID 82224699
N-(3-aminophenyl)-2-(1,4-diazepan-1-yl)butanamide (PubChem CID 82224699) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(1,4-diazepan-1-yl)butanamide.
| Compound Name | N-(3-aminophenyl)-2-(1,4-diazepan-1-yl)butanamide |
|---|---|
| PubChem CID | 82224699 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-(3-aminophenyl)-2-(1,4-diazepan-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cccc(N)c1)N1CCCNCC1 |
| InChI | InChI=1S/C15H24N4O/c1-2-14(19-9-4-7-17-8-10-19)15(20)18-13-6-3-5-12(16)11-13/h3,5-6,11,14,17H,2,4,7-10,16H2,1H3,(H,18,20) |
| InChIKey | VDYDMXCBLYKTGV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|