C18H24N2O — CID 82256376
2-[bis(prop-2-enyl)amino]-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one (PubChem CID 82256376) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one.
| Compound Name | 2-[bis(prop-2-enyl)amino]-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 82256376 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-1-(2,3-dihydro-1H-indol-5-yl)butan-1-one |
| SMILES | C=CCN(CC=C)C(CC)C(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C18H24N2O/c1-4-11-20(12-5-2)17(6-3)18(21)15-7-8-16-14(13-15)9-10-19-16/h4-5,7-8,13,17,19H,1-2,6,9-12H2,3H3 |
| InChIKey | FCGWTINFZXZJMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|