C16H23N3O — CID 82256389
1-(2,3-dihydro-1H-indol-5-yl)-2-piperazin-1-ylbutan-1-one (PubChem CID 82256389) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-2-piperazin-1-ylbutan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 82256389 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-piperazin-1-ylbutan-1-one |
| SMILES | CCC(C(=O)c1ccc2c(c1)CCN2)N1CCNCC1 |
| InChI | InChI=1S/C16H23N3O/c1-2-15(19-9-7-17-8-10-19)16(20)13-3-4-14-12(11-13)5-6-18-14/h3-4,11,15,17-18H,2,5-10H2,1H3 |
| InChIKey | BNMOXFNDVBQVDS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |