C21H21F3N2O — CID 129293857
(E)-4-[2,3-dihydro-1H-indol-5-ylmethyl(ethyl)amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one (PubChem CID 129293857) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is (E)-4-[2,3-dihydro-1H-indol-5-ylmethyl(ethyl)amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one.
| Compound Name | (E)-4-[2,3-dihydro-1H-indol-5-ylmethyl(ethyl)amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 129293857 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (E)-4-[2,3-dihydro-1H-indol-5-ylmethyl(ethyl)amino]-1,1,1-trifluoro-3-phenylbut-3-en-2-one |
| SMILES | CCN(/C=C(/C(=O)C(F)(F)F)c1ccccc1)Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C21H21F3N2O/c1-2-26(13-15-8-9-19-17(12-15)10-11-25-19)14-18(20(27)21(22,23)24)16-6-4-3-5-7-16/h3-9,12,14,25H,2,10-11,13H2,1H3/b18-14+ |
| InChIKey | HJIGHMDHAKCTJY-NBVRZTHBSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|