2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate

C15H21NO4 — CID 103178589

IUPAC2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate
SMILESCOCCCOCCOC(=O)c1ccc2c(c1)CCN2
InChIInChI=1S/C15H21NO4/c1-18-7-2-8-19-9-10-20-15(17)13-3-4-14-12(11-13)5-6-16-14/h3-4,11,16H,2,5-10H2,1H3
InChIKeyNCOAVJPGGZBLHH-UHFFFAOYSA-N
MW279.34 g/mol
LogP1.86
Rot. Bonds8

About 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate

2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate (PubChem CID 103178589) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate.

Molecular Properties

Compound Name2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate
PubChem CID103178589
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Name2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate
SMILESCOCCCOCCOC(=O)c1ccc2c(c1)CCN2
InChIInChI=1S/C15H21NO4/c1-18-7-2-8-19-9-10-20-15(17)13-3-4-14-12(11-13)5-6-16-14/h3-4,11,16H,2,5-10H2,1H3
InChIKeyNCOAVJPGGZBLHH-UHFFFAOYSA-N
XLogP1.86
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate?
The IUPAC name of 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate (CID 103178589) is 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate.
What is the SMILES notation for 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate?
The canonical SMILES for 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate is COCCCOCCOC(=O)c1ccc2c(c1)CCN2.
What is the InChIKey of 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate?
The InChIKey is NCOAVJPGGZBLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-18-7-2-8-19-9-10-20-15(17)13-3-4-14-12(11-13)5-6-16-14/h3-4,11,16H,2,5-10H2,1H3.
What are the key properties of 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate?
2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate has a molecular weight of 279.34 g/mol, XLogP of 1.86, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropoxy)ethyl 2,3-dihydro-1H-indole-5-carboxylate is sourced from PubChem (CID 103178589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).