C9H7F3O3 — CID 2781162
3,3,3-trifluoro-1-phenylpropane-1,2-dione;hydrate (PubChem CID 2781162) has the molecular formula C9H7F3O3 and a molecular weight of 220.15 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-phenylpropane-1,2-dione;hydrate.
| Compound Name | 3,3,3-trifluoro-1-phenylpropane-1,2-dione;hydrate |
|---|---|
| PubChem CID | 2781162 |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3,3,3-trifluoro-1-phenylpropane-1,2-dione;hydrate |
| SMILES | O.O=C(C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H5F3O2.H2O/c10-9(11,12)8(14)7(13)6-4-2-1-3-5-6;/h1-5H;1H2 |
| InChIKey | PSKYXWMZYBYVDK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|