C17H11F3O2 — CID 126359991
(2Z)-2-benzylidene-4,4,4-trifluoro-1-phenylbutane-1,3-dione (PubChem CID 126359991) has the molecular formula C17H11F3O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4,4,4-trifluoro-1-phenylbutane-1,3-dione.
| Compound Name | (2Z)-2-benzylidene-4,4,4-trifluoro-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 126359991 |
| Molecular Formula | C17H11F3O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2Z)-2-benzylidene-4,4,4-trifluoro-1-phenylbutane-1,3-dione |
| SMILES | O=C(/C(=C/c1ccccc1)C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H11F3O2/c18-17(19,20)16(22)14(11-12-7-3-1-4-8-12)15(21)13-9-5-2-6-10-13/h1-11H/b14-11- |
| InChIKey | GXUZQXSVSHLXJO-KAMYIIQDSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|